Products 1201080-23-0

CAS 1201080-23-0 is the registry number for Neratinib Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-acetamido-4-ethoxy-2-nitrobenzoate (CAS 1201080-23-0) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: methyl 5-acetamido-4-ethoxy-2-nitrobenzoate. InChIKey: SUNFXTJKUZVRCZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O6
Molecular weight282.25 g/mol
IUPAC namemethyl 5-acetamido-4-ethoxy-2-nitrobenzoate
InChIKeySUNFXTJKUZVRCZ-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)OC)NC(=O)C

Computed by PubChem (NCBI)