CAS 1201080-23-0 is the registry number for Neratinib Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-acetamido-4-ethoxy-2-nitrobenzoate (CAS 1201080-23-0) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: methyl 5-acetamido-4-ethoxy-2-nitrobenzoate. InChIKey: SUNFXTJKUZVRCZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | methyl 5-acetamido-4-ethoxy-2-nitrobenzoate |
| InChIKey | SUNFXTJKUZVRCZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)OC)NC(=O)C |
Computed by PubChem (NCBI)