CAS 74929-17-2 is the registry number for L-glutamicacidgamma-(3-carboxy-4-hydroxyanilidE), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid (CAS 74929-17-2) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid. InChIKey: SXXQCQDCWZFRGY-QMMMGPOBSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 5-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-hydroxybenzoic acid |
| InChIKey | SXXQCQDCWZFRGY-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CC[C@@H](C(=O)O)N)C(=O)O)O |
Computed by PubChem (NCBI)