Products 2248319-77-7

CAS 2248319-77-7 is the registry number for Candesartan Cilexetil Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrobenzoic acid (CAS 2248319-77-7) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrobenzoic acid. InChIKey: YHVNSQNDUXHQLH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O6
Molecular weight282.25 g/mol
IUPAC name2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-nitrobenzoic acid
InChIKeyYHVNSQNDUXHQLH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=CC=C1[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)