Products 959750-83-5
CAS 959750-83-5 is the registry number for 3-((tert-Butoxycarbonyl)amino)-5-nitrobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitrobenzoic acid (CAS 959750-83-5) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitrobenzoic acid. InChIKey: IXFJUVRBZSABBT-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-nitrobenzoic acid |
| InChIKey | IXFJUVRBZSABBT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)