CAS 1201192-62-2 appears in our catalog under these names: 1-tert-Butyl 3-methyl 4-methylpiperidine-1,3-dicarboxylate, 95%, 1–tert–Butyl 3–methyl 4–methylpiperidine–1,3–dicarboxylate, 1-tert-Butyl 3-methyl 4-methylpiperidine-1,3-dicarboxylate, 95%, 95%, 1-TERT-BUTYL 3-METHYL 4-METHYLPIPERIDINE-1,3-DICARBOXYLATE, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 3-O-methyl 4-methylpiperidine-1,3-dicarboxylate (CAS 1201192-62-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 4-methylpiperidine-1,3-dicarboxylate. InChIKey: CUBAIJGHSDICOZ-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 4-methylpiperidine-1,3-dicarboxylate |
| InChIKey | CUBAIJGHSDICOZ-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)