Products 1201575-00-9
CAS 1201575-00-9 is the registry number for (3R,4S)-1-Benzyl-4-phenylpyrrolidine-3-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R,4S)-1-benzyl-4-phenylpyrrolidine-3-carbonitrile (CAS 1201575-00-9) is a chemical compound with the molecular formula C18H18N2 and a molecular weight of 262.3 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-phenylpyrrolidine-3-carbonitrile. InChIKey: LHKVKWYSDARUCV-ZWKOTPCHSA-N.
| Molecular formula | C18H18N2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-phenylpyrrolidine-3-carbonitrile |
| InChIKey | LHKVKWYSDARUCV-ZWKOTPCHSA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)