Products 6208-43-1

CAS 6208-43-1 is the registry number for 2-Benzyl-1H,2H,3H,4H,5H-pyrido(4,3-b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-benzyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (CAS 6208-43-1) is a chemical compound with the molecular formula C18H18N2 and a molecular weight of 262.3 g/mol. IUPAC name: 2-benzyl-1,3,4,5-tetrahydropyrido[4,3-b]indole. InChIKey: TWZCZLLZJDKWFN-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2
Molecular weight262.3 g/mol
IUPAC name2-benzyl-1,3,4,5-tetrahydropyrido[4,3-b]indole
InChIKeyTWZCZLLZJDKWFN-UHFFFAOYSA-N
SMILESC1CN(CC2=C1NC3=CC=CC=C23)CC4=CC=CC=C4

Computed by PubChem (NCBI)