CAS 2007919-84-6 appears in our catalog under these names: 1-(Diphenylmethyl)-2-methylazetidine-3-carbonitrile,cis-, 95%, 1-(diphenylmethyl)-2-methylazetidine-3-carbonitrile,cis-, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg.
(2R,3R)-1-benzhydryl-2-methylazetidine-3-carbonitrile (CAS 2007919-84-6) is a chemical compound with the molecular formula C18H18N2 and a molecular weight of 262.3 g/mol. IUPAC name: (2R,3R)-1-benzhydryl-2-methylazetidine-3-carbonitrile. InChIKey: FWCNLDUDKXUUDF-RHSMWYFYSA-N.
| Molecular formula | C18H18N2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | (2R,3R)-1-benzhydryl-2-methylazetidine-3-carbonitrile |
| InChIKey | FWCNLDUDKXUUDF-RHSMWYFYSA-N |
| SMILES | C[C@@H]1[C@@H](CN1C(C2=CC=CC=C2)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)