Products 2865073-16-9
CAS 2865073-16-9 is the registry number for (2R,3S)-1-benzhydryl-2-methyl-azetidine-3-carbonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
(2R,3S)-1-benzhydryl-2-methylazetidine-3-carbonitrile (CAS 2865073-16-9) is a chemical compound with the molecular formula C18H18N2 and a molecular weight of 262.3 g/mol. IUPAC name: (2R,3S)-1-benzhydryl-2-methylazetidine-3-carbonitrile. InChIKey: FWCNLDUDKXUUDF-PBHICJAKSA-N.
| Molecular formula | C18H18N2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | (2R,3S)-1-benzhydryl-2-methylazetidine-3-carbonitrile |
| InChIKey | FWCNLDUDKXUUDF-PBHICJAKSA-N |
| SMILES | C[C@@H]1[C@H](CN1C(C2=CC=CC=C2)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)