Products 787618-47-7
CAS 787618-47-7 is the registry number for 1-Benzyl-4-(2,3-dimethylphenyl)-1H-pyrazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-benzyl-4-(2,3-dimethylphenyl)pyrazole (CAS 787618-47-7) is a chemical compound with the molecular formula C18H18N2 and a molecular weight of 262.3 g/mol. IUPAC name: 1-benzyl-4-(2,3-dimethylphenyl)pyrazole. InChIKey: SSZKIYKKXFJTDJ-UHFFFAOYSA-N.
| Molecular formula | C18H18N2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | 1-benzyl-4-(2,3-dimethylphenyl)pyrazole |
| InChIKey | SSZKIYKKXFJTDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2=CN(N=C2)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)