Products 1202002-16-1

CAS 1202002-16-1 is the registry number for Avanafil Impurity 34. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-pyrimidin-2-yl-N-(pyrimidin-2-ylmethyl)methanamine (CAS 1202002-16-1) is a chemical compound with the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. IUPAC name: 1-pyrimidin-2-yl-N-(pyrimidin-2-ylmethyl)methanamine. InChIKey: YRWCMZCQDSFCJR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N5
Molecular weight201.23 g/mol
IUPAC name1-pyrimidin-2-yl-N-(pyrimidin-2-ylmethyl)methanamine
InChIKeyYRWCMZCQDSFCJR-UHFFFAOYSA-N
SMILESC1=CN=C(N=C1)CNCC2=NC=CC=N2

Computed by PubChem (NCBI)