CAS 666823-18-3 appears in our catalog under these names: 3–Ethyl–1–methyl–1H–imidazol–3–ium Tricyanomethanide, 1-Ethyl-3-methylimidazolium tricyanomethanide, 98%, 1-Ethyl-3-Methylimidazolium Tricyanomethanide, 98%, 98%, 1-Ethyl-3-methylimidazolium Tricyanomethanide, >98.0%(HPLC)(N). Offered by: GLPBio, Combi-blocks, Chemat, TCI. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
2,2-dicyanoethenylideneazanide;1-ethyl-3-methylimidazol-3-ium (CAS 666823-18-3) is a chemical compound with the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. IUPAC name: 2,2-dicyanoethenylideneazanide;1-ethyl-3-methylimidazol-3-ium. InChIKey: SCAQVLGGENTPGK-UHFFFAOYSA-N.
| Molecular formula | C10H11N5 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 2,2-dicyanoethenylideneazanide;1-ethyl-3-methylimidazol-3-ium |
| InChIKey | SCAQVLGGENTPGK-UHFFFAOYSA-N |
| SMILES | CCN1C=C[N+](=C1)C.C(=C(C#N)C#N)=[N-] |
Computed by PubChem (NCBI)