Products 949444-82-0
CAS 949444-82-0 appears in our catalog under these names: 4-(1-Cyclopropyl-1h-tetrazol-5-yl)aniline, 95%, 4-(1-Cyclopropyl-1H-1,2,3,4-tetrazol-5-yl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(1-cyclopropyltetrazol-5-yl)aniline (CAS 949444-82-0) is a chemical compound with the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. IUPAC name: 4-(1-cyclopropyltetrazol-5-yl)aniline. InChIKey: CBCHVBDISUGGOQ-UHFFFAOYSA-N.
| Molecular formula | C10H11N5 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 4-(1-cyclopropyltetrazol-5-yl)aniline |
| InChIKey | CBCHVBDISUGGOQ-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=NN=N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)