CAS 19338-12-6 appears in our catalog under these names: 2,4-Diamino-6-(4-methylphenyl)-1,3,5-triazine, 95%, 6-(p-Tolyl)-1,3,5-triazine-2,4-diamine, 97%, 6-(p-Tolyl)-1,3,5-triazine-2,4-diamine, 97%, 97%, 2,4-Diamino-6-(4-methylphenyl)-1,3,5-triazine, 99%(HPLC),RG. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (CAS 19338-12-6) is a chemical compound with the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. IUPAC name: 6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: DECZZKFYYMMMCQ-UHFFFAOYSA-N.
| Molecular formula | C10H11N5 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | DECZZKFYYMMMCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)