CAS 19079-41-5 is the registry number for N2-(p-Tolyl)-1,3,5-triazine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (CAS 19079-41-5) is a chemical compound with the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. IUPAC name: 2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: LBFNSNKYVMKEFX-UHFFFAOYSA-N.
| Molecular formula | C10H11N5 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | LBFNSNKYVMKEFX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC=NC(=N2)N |
Computed by PubChem (NCBI)