Products 1202030-53-2
CAS 1202030-53-2 is the registry number for Methyl 1-benzyl-3-(4-chlorophenyl)-1H-pyrazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
Methyl 1-benzyl-3-(4-chlorophenyl)pyrazole-5-carboxylate (CAS 1202030-53-2) is a chemical compound with the molecular formula C18H15ClN2O2 and a molecular weight of 326.8 g/mol. IUPAC name: methyl 1-benzyl-3-(4-chlorophenyl)pyrazole-5-carboxylate. InChIKey: FCVUJTKQNKDFQF-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O2 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | methyl 1-benzyl-3-(4-chlorophenyl)pyrazole-5-carboxylate |
| InChIKey | FCVUJTKQNKDFQF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NN1CC2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)