Products 63673-72-3
CAS 63673-72-3 is the registry number for 2-Chloro-4,6-bis(4-methoxyphenyl)pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-chloro-4,6-bis(4-methoxyphenyl)pyrimidine (CAS 63673-72-3) is a chemical compound with the molecular formula C18H15ClN2O2 and a molecular weight of 326.8 g/mol. IUPAC name: 2-chloro-4,6-bis(4-methoxyphenyl)pyrimidine. InChIKey: DKOMXBVVTZTZDB-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O2 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 2-chloro-4,6-bis(4-methoxyphenyl)pyrimidine |
| InChIKey | DKOMXBVVTZTZDB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=NC(=N2)Cl)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)