Products 309711-72-6
CAS 309711-72-6 is the registry number for NS 1231. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-chlorophenyl)-3-nitroso-6,7,8,9-tetrahydro-1H-benzo[g]indol-2-ol (CAS 309711-72-6) is a chemical compound with the molecular formula C18H15ClN2O2 and a molecular weight of 326.8 g/mol. IUPAC name: 5-(4-chlorophenyl)-3-nitroso-6,7,8,9-tetrahydro-1H-benzo[g]indol-2-ol. InChIKey: GVJBKTWCHWZHDA-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O2 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-3-nitroso-6,7,8,9-tetrahydro-1H-benzo[g]indol-2-ol |
| InChIKey | GVJBKTWCHWZHDA-UHFFFAOYSA-N |
| SMILES | C1CCC2=C3C(=CC(=C2C1)C4=CC=C(C=C4)Cl)C(=C(N3)O)N=O |
Computed by PubChem (NCBI)