CAS 42262-96-4 is the registry number for 2-Chloro-3-{(4-(dimethylamino)phenyl)amino}-1,4-dihydronaphthalene-1,4-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-3-[4-(dimethylamino)anilino]naphthalene-1,4-dione (CAS 42262-96-4) is a chemical compound with the molecular formula C18H15ClN2O2 and a molecular weight of 326.8 g/mol. IUPAC name: 2-chloro-3-[4-(dimethylamino)anilino]naphthalene-1,4-dione. InChIKey: IFCBGAQTKDYXAL-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O2 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 2-chloro-3-[4-(dimethylamino)anilino]naphthalene-1,4-dione |
| InChIKey | IFCBGAQTKDYXAL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NC2=C(C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)