CAS 300377-64-4 is the registry number for (3-(2-Chlorophenyl)-5-methylisoxazol-4-yl)-N-benzylformamide. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
N-benzyl-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (CAS 300377-64-4) is a chemical compound with the molecular formula C18H15ClN2O2 and a molecular weight of 326.8 g/mol. IUPAC name: N-benzyl-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide. InChIKey: FWYSCQIJGIRKDH-UHFFFAOYSA-N.
| Molecular formula | C18H15ClN2O2 |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | N-benzyl-3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| InChIKey | FWYSCQIJGIRKDH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)