CAS 1202063-94-2 is the registry number for 1-13C-D-Phenylalanine. Offered by: TRC. Available pack sizes: 25mg.
(2R)-2-amino-3-phenyl(113C)propanoic acid (CAS 1202063-94-2) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: (2R)-2-amino-3-phenyl(113C)propanoic acid. InChIKey: COLNVLDHVKWLRT-OHEVQBQUSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2R)-2-amino-3-phenyl(113C)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-OHEVQBQUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H]([13C](=O)O)N |
Computed by PubChem (NCBI)