CAS 81201-86-7 appears in our catalog under these names: L-Phenylalanine-carboxy-13C, L-PHENYLALANINE-1-13C, 99 ATOM % 13C, L-Phenylalanine-13C, 99 atom % 13C, 99 atom % 13C, L-Phenylalanine-13C, 99.66%. Offered by: TRC, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 25mg, 1G, 250MG, 50 mg, 250 mg, 5 mg, 10 mg, 100 mg.
(2S)-2-amino-3-phenyl(113C)propanoic acid (CAS 81201-86-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-amino-3-phenyl(113C)propanoic acid. InChIKey: COLNVLDHVKWLRT-DMSOPOIOSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-amino-3-phenyl(113C)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-DMSOPOIOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)