CAS 29700-34-3 appears in our catalog under these names: H-(15N)Phe-OH, L-(15N)Phenylalanine, >95% (HPLC), L-Phenylalanine-15N/ 98.91% (existing batch purity), L–Phenylalanine–15N, L-PHENYLALANINE-15N, 98+ ATOM % 15N. Offered by: Creative Peptides, TRC, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 10mg, 50mg, 25mg, 5mg, 500MG, 10 mg.
(2S)-2-(15N)azanyl-3-phenylpropanoic acid (CAS 29700-34-3) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 166.18 g/mol. IUPAC name: (2S)-2-(15N)azanyl-3-phenylpropanoic acid. InChIKey: COLNVLDHVKWLRT-YTRLMEAHSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-3-phenylpropanoic acid |
| InChIKey | COLNVLDHVKWLRT-YTRLMEAHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)