CAS 17942-32-4 appears in our catalog under these names: L-Phenylalanine-d8, L-Phenyl-d5-alanine-2,3,3-d3, L-Phenyl-d5-alanine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, L–Phenylalanine–d8, L-PHENYLALANINE-ALPHA,BETA,BETA,2,3,4,5&. Offered by: Chemat Brand, TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 0,25g, 0,1g, 1mg, 5mg.
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 17942-32-4) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 173.24 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: COLNVLDHVKWLRT-WYMAAGAPSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 173.24 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-WYMAAGAPSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)