CAS 1202064-02-5 appears in our catalog under these names: D–Phenylalanine–d8, D-Phenyl-d5-alanine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, D-Phenylalanine-d8, 98.28%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 5mg, 0,05g, 0,01g, 1mg, 10mg, 10 mg, 1 mg, 5 mg.
(2R)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 1202064-02-5) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 173.24 g/mol. IUPAC name: (2R)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: COLNVLDHVKWLRT-HNZZJFTQSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 173.24 g/mol |
| IUPAC name | (2R)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-HNZZJFTQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@]([2H])(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)