Products 73036-42-7
CAS 73036-42-7 appears in our catalog under these names: DL-4-Hydroxyphenyl-2,6-d2-alanine-2-d1, 98 atom % D, min 98% Chemical Purity, DL-Tyrosine-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5mg, 1mg.
2-amino-2-deuterio-3-(2,6-dideuterio-4-hydroxyphenyl)propanoic acid (CAS 73036-42-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 184.21 g/mol. IUPAC name: 2-amino-2-deuterio-3-(2,6-dideuterio-4-hydroxyphenyl)propanoic acid. InChIKey: OUYCCCASQSFEME-GNRMPFMLSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 184.21 g/mol |
| IUPAC name | 2-amino-2-deuterio-3-(2,6-dideuterio-4-hydroxyphenyl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-GNRMPFMLSA-N |
| SMILES | [2H]C1=CC(=CC(=C1CC([2H])(C(=O)O)N)[2H])O |
Computed by PubChem (NCBI)