CAS 1202158-30-2 is the registry number for rel-(1R,2R)-2-Fluorocyclohexanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Cis-(1R,2S)-2-fluorocyclohexan-1-amine;hydrochloride (CAS 1202158-30-2) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: cis-(1R,2S)-2-fluorocyclohexan-1-amine;hydrochloride. InChIKey: IOXBYKGOFZSEIL-RIHPBJNCSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | cis-(1R,2S)-2-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | IOXBYKGOFZSEIL-RIHPBJNCSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)N)F.Cl |
Computed by PubChem (NCBI)