CAS 1335302-62-9 appears in our catalog under these names: (1R,2S)-2-fluorocyclohexanamine hydrochloride, 97+%, (1S,2R)-2-Fluorocyclohexanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Cis-(1S,2R)-2-fluorocyclohexan-1-amine;hydrochloride (CAS 1335302-62-9) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: cis-(1S,2R)-2-fluorocyclohexan-1-amine;hydrochloride. InChIKey: IOXBYKGOFZSEIL-IBTYICNHSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | cis-(1S,2R)-2-fluorocyclohexan-1-amine;hydrochloride |
| InChIKey | IOXBYKGOFZSEIL-IBTYICNHSA-N |
| SMILES | C1CC[C@H]([C@H](C1)N)F.Cl |
Computed by PubChem (NCBI)