Products 1202163-46-9
CAS 1202163-46-9 appears in our catalog under these names: Methyl 5-bromo-2,6-dimethoxynicotinate, 95%, Methyl 5-bromo-2,6-dimethoxynicotinate 95+%, Methyl 5-bromo-2,6-dimethoxynicotinate, 95+%, 95+%, Methyl 5-bromo-2,6-dimethoxynicotinate, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 1g.
Methyl 5-bromo-2,6-dimethoxypyridine-3-carboxylate (CAS 1202163-46-9) is a chemical compound with the molecular formula C9H10BrNO4 and a molecular weight of 276.08 g/mol. IUPAC name: methyl 5-bromo-2,6-dimethoxypyridine-3-carboxylate. InChIKey: SGGLNDREJAQOHT-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4 |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | methyl 5-bromo-2,6-dimethoxypyridine-3-carboxylate |
| InChIKey | SGGLNDREJAQOHT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)C(=O)OC)Br |
Computed by PubChem (NCBI)