CAS 53413-67-5 appears in our catalog under these names: 4,5-Dimethoxy-2-nitrobenzyl bromide, 96%, 4,5–Dimethoxy–2–nitrobenzyl bromide, 4,5-Dimethoxy-2-nitrobenzyl bromide, 97%, 1-(Bromomethyl)-4,5-dimethoxy-2-nitrobenzene 96%, 4,5-dimethoxy-2-nitrobenzyl bromide, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 2g.
1-(bromomethyl)-4,5-dimethoxy-2-nitrobenzene (CAS 53413-67-5) is a chemical compound with the molecular formula C9H10BrNO4 and a molecular weight of 276.08 g/mol. IUPAC name: 1-(bromomethyl)-4,5-dimethoxy-2-nitrobenzene. InChIKey: UEKFEYNZISYRRH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4 |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 1-(bromomethyl)-4,5-dimethoxy-2-nitrobenzene |
| InChIKey | UEKFEYNZISYRRH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CBr)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)