CAS 2113995-55-2 is the registry number for 2-Ethyl 5-methyl 3-bromo-1H-pyrrole-2,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-ethyl 5-O-methyl 3-bromo-1H-pyrrole-2,5-dicarboxylate (CAS 2113995-55-2) is a chemical compound with the molecular formula C9H10BrNO4 and a molecular weight of 276.08 g/mol. IUPAC name: 2-O-ethyl 5-O-methyl 3-bromo-1H-pyrrole-2,5-dicarboxylate. InChIKey: LPTNFBXQPQEYDQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4 |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 2-O-ethyl 5-O-methyl 3-bromo-1H-pyrrole-2,5-dicarboxylate |
| InChIKey | LPTNFBXQPQEYDQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(N1)C(=O)OC)Br |
Computed by PubChem (NCBI)