Products 214123-12-3

CAS 214123-12-3 is the registry number for Methyl 6-bromo-4,5-dimethoxypicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate (CAS 214123-12-3) is a chemical compound with the molecular formula C9H10BrNO4 and a molecular weight of 276.08 g/mol. IUPAC name: methyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate. InChIKey: GOYXLBBPBTXHBV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrNO4
Molecular weight276.08 g/mol
IUPAC namemethyl 6-bromo-4,5-dimethoxypyridine-2-carboxylate
InChIKeyGOYXLBBPBTXHBV-UHFFFAOYSA-N
SMILESCOC1=CC(=NC(=C1OC)Br)C(=O)OC

Computed by PubChem (NCBI)