Products 1248106-15-1
CAS 1248106-15-1 appears in our catalog under these names: 4-Bromo-1-(2-methoxyethoxy)-2-nitrobenzene, 4-Bromo-1-(2-methoxyethoxy)-2-nitrobenzene, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 1g, 5g.
4-bromo-1-(2-methoxyethoxy)-2-nitrobenzene (CAS 1248106-15-1) is a chemical compound with the molecular formula C9H10BrNO4 and a molecular weight of 276.08 g/mol. IUPAC name: 4-bromo-1-(2-methoxyethoxy)-2-nitrobenzene. InChIKey: JDMAYXLFPMODFC-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4 |
|---|---|
| Molecular weight | 276.08 g/mol |
| IUPAC name | 4-bromo-1-(2-methoxyethoxy)-2-nitrobenzene |
| InChIKey | JDMAYXLFPMODFC-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)