Products 1202478-42-9
CAS 1202478-42-9 appears in our catalog under these names: (S)–Cyclobutyl(phenyl)methanamine hydrochloride, (S)-Cyclobutyl(phenyl)methanamine hydrochloride, (S)-Cyclobutyl(phenyl)methanamine hydrochloride 97%, (S)-Cyclobutyl(phenyl)methanamine hydrochloride, 96%, 96%, (S)-CYCLOBUTYL(PHENYL)METHANAMINE HCL, 96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
(S)-cyclobutyl(phenyl)methanamine;hydrochloride (CAS 1202478-42-9) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (S)-cyclobutyl(phenyl)methanamine;hydrochloride. InChIKey: AAOLJOPKUMMRSZ-RFVHGSKJSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (S)-cyclobutyl(phenyl)methanamine;hydrochloride |
| InChIKey | AAOLJOPKUMMRSZ-RFVHGSKJSA-N |
| SMILES | C1CC(C1)[C@@H](C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)