Products 1956435-19-0
CAS 1956435-19-0 appears in our catalog under these names: (R)–Cyclobutyl(phenyl)methanamine hydrochloride, (R)-Cyclobutyl(phenyl)methanamine hydrochloride, 97%, 97%, (R)-CYCLOBUTYL(PHENYL)METHANAMINE HCL, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(R)-cyclobutyl(phenyl)methanamine;hydrochloride (CAS 1956435-19-0) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (R)-cyclobutyl(phenyl)methanamine;hydrochloride. InChIKey: AAOLJOPKUMMRSZ-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (R)-cyclobutyl(phenyl)methanamine;hydrochloride |
| InChIKey | AAOLJOPKUMMRSZ-MERQFXBCSA-N |
| SMILES | C1CC(C1)[C@H](C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)