CAS 1202679-47-7 is the registry number for 2',6'-Difluoro-3'-(trifluoromethyl)acetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2,6-difluoro-3-(trifluoromethyl)phenyl]ethanone (CAS 1202679-47-7) is a chemical compound with the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. IUPAC name: 1-[2,6-difluoro-3-(trifluoromethyl)phenyl]ethanone. InChIKey: YCSWEAQKFAHIRJ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 1-[2,6-difluoro-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | YCSWEAQKFAHIRJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1F)C(F)(F)F)F |
Computed by PubChem (NCBI)