CAS 1343484-90-1 is the registry number for 3-(2,4-Difluorophenyl)-1,1,1-trifluoropropan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2,4-difluorophenyl)-1,1,1-trifluoropropan-2-one (CAS 1343484-90-1) is a chemical compound with the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. IUPAC name: 3-(2,4-difluorophenyl)-1,1,1-trifluoropropan-2-one. InChIKey: YDAKFMBROPVOFN-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 3-(2,4-difluorophenyl)-1,1,1-trifluoropropan-2-one |
| InChIKey | YDAKFMBROPVOFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)