CAS 19225-86-6 appears in our catalog under these names: 1-(pentafluorophenyl)propan-2-one, 95%, (2,3,4,5,6-Pentafluorophenyl)cetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
1-(2,3,4,5,6-pentafluorophenyl)propan-2-one (CAS 19225-86-6) is a chemical compound with the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. IUPAC name: 1-(2,3,4,5,6-pentafluorophenyl)propan-2-one. InChIKey: UEYLUHZTMXOIMB-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentafluorophenyl)propan-2-one |
| InChIKey | UEYLUHZTMXOIMB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)