CAS 394-52-5 is the registry number for Pentafluoroethyl phenyl ketone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2,2,3,3,3-pentafluoro-1-phenylpropan-1-one (CAS 394-52-5) is a chemical compound with the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. IUPAC name: 2,2,3,3,3-pentafluoro-1-phenylpropan-1-one. InChIKey: VUBUXALTYMBEQO-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 2,2,3,3,3-pentafluoro-1-phenylpropan-1-one |
| InChIKey | VUBUXALTYMBEQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)