Products 394-52-5

CAS 394-52-5 is the registry number for Pentafluoroethyl phenyl ketone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,2,3,3,3-pentafluoro-1-phenylpropan-1-one (CAS 394-52-5) is a chemical compound with the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. IUPAC name: 2,2,3,3,3-pentafluoro-1-phenylpropan-1-one. InChIKey: VUBUXALTYMBEQO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5F5O
Molecular weight224.13 g/mol
IUPAC name2,2,3,3,3-pentafluoro-1-phenylpropan-1-one
InChIKeyVUBUXALTYMBEQO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C(C(F)(F)F)(F)F

Computed by PubChem (NCBI)