CAS 237761-82-9 appears in our catalog under these names: 1-(2,3-Difluoro-4-(trifluoromethyl)phenyl)ethanone, 95%, 2,3–Difluoro–4–(trifluoromethyl)acetophenone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-[2,3-difluoro-4-(trifluoromethyl)phenyl]ethanone (CAS 237761-82-9) is a chemical compound with the molecular formula C9H5F5O and a molecular weight of 224.13 g/mol. IUPAC name: 1-[2,3-difluoro-4-(trifluoromethyl)phenyl]ethanone. InChIKey: RRICBVAPDZGCHB-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 1-[2,3-difluoro-4-(trifluoromethyl)phenyl]ethanone |
| InChIKey | RRICBVAPDZGCHB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)C(F)(F)F)F)F |
Computed by PubChem (NCBI)