CAS 120281-56-3 appears in our catalog under these names: 2-Iodo-5-phenylpyridine, 95%, 2-Iodo-5-phenylpyridine, 95+%, 2–Iodo–5–phenylpyridine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 10g, 25g.
2-iodo-5-phenylpyridine (CAS 120281-56-3) is a chemical compound with the molecular formula C11H8IN and a molecular weight of 281.09 g/mol. IUPAC name: 2-iodo-5-phenylpyridine. InChIKey: OJEKXUIQUYRHNP-UHFFFAOYSA-N.
| Molecular formula | C11H8IN |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 2-iodo-5-phenylpyridine |
| InChIKey | OJEKXUIQUYRHNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(C=C2)I |
Computed by PubChem (NCBI)