CAS 83420-59-1 appears in our catalog under these names: 4-(4-Iodophenyl)pyridine 95%, 4-(4-Iodophenyl)pyridine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-iodophenyl)pyridine (CAS 83420-59-1) is a chemical compound with the molecular formula C11H8IN and a molecular weight of 281.09 g/mol. IUPAC name: 4-(4-iodophenyl)pyridine. InChIKey: UDXJNRYHGQJHGL-UHFFFAOYSA-N.
| Molecular formula | C11H8IN |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 4-(4-iodophenyl)pyridine |
| InChIKey | UDXJNRYHGQJHGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)I |
Computed by PubChem (NCBI)