CAS 897440-10-7 appears in our catalog under these names: 2-(2-Iodophenyl)pyridine, 95-<97%, 2-(2-Iodophenyl)pyridine 95%. Offered by: Hoffman Fine Chemicals, Ambeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg, 1g.
2-(2-iodophenyl)pyridine (CAS 897440-10-7) is a chemical compound with the molecular formula C11H8IN and a molecular weight of 281.09 g/mol. IUPAC name: 2-(2-iodophenyl)pyridine. InChIKey: HMNMKCFTSAKOQP-UHFFFAOYSA-N.
| Molecular formula | C11H8IN |
|---|---|
| Molecular weight | 281.09 g/mol |
| IUPAC name | 2-(2-iodophenyl)pyridine |
| InChIKey | HMNMKCFTSAKOQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)I |
Computed by PubChem (NCBI)