CAS 120287-30-1 appears in our catalog under these names: 8-Bromo-6-nitroquinoline 97%, 8-Bromo-6-nitroquinoline, 98%, 98%, 8-BROMO-6-NITROQUINOLINE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
8-bromo-6-nitroquinoline (CAS 120287-30-1) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 8-bromo-6-nitroquinoline. InChIKey: ROMYKZIUOIXCRR-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 8-bromo-6-nitroquinoline |
| InChIKey | ROMYKZIUOIXCRR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)