Products 1203101-29-4
CAS 1203101-29-4 appears in our catalog under these names: 4-Dimethylamino-benzamidine dihydrochloride, 95%, 4-(Dimethylamino)benzene-1-carboximidamide dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
4-(dimethylamino)benzenecarboximidamide;dihydrochloride (CAS 1203101-29-4) is a chemical compound with the molecular formula C9H15Cl2N3 and a molecular weight of 236.14 g/mol. IUPAC name: 4-(dimethylamino)benzenecarboximidamide;dihydrochloride. InChIKey: QVWJLPLJSLCQMX-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 4-(dimethylamino)benzenecarboximidamide;dihydrochloride |
| InChIKey | QVWJLPLJSLCQMX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=N)N.Cl.Cl |
Computed by PubChem (NCBI)