CAS 1956380-40-7 appears in our catalog under these names: 2,3,4,5-Tetrahydro-1h-benzo[e][1,4]diazepin-7-ylamine dihydrochloride, 95%, 2,3,4,5-Tetrahydro-1H-benzo(e)(1,4)diazepin-7-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-amine;dihydrochloride (CAS 1956380-40-7) is a chemical compound with the molecular formula C9H15Cl2N3 and a molecular weight of 236.14 g/mol. IUPAC name: 2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-amine;dihydrochloride. InChIKey: GNGWGHPEPCERBR-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-7-amine;dihydrochloride |
| InChIKey | GNGWGHPEPCERBR-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(CN1)C=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)