CAS 1955530-18-3 appears in our catalog under these names: 5-(1-Methyl-1H-pyrazol-4-yl)-1,2,3,6-tetrahydropyridine dihydrochloride, 95%, 5-(1-Methyl-1H-pyrazol-4-yl)-1,2,3,6-tetrahydropyridine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(1-methylpyrazol-4-yl)-1,2,3,6-tetrahydropyridine;dihydrochloride (CAS 1955530-18-3) is a chemical compound with the molecular formula C9H15Cl2N3 and a molecular weight of 236.14 g/mol. IUPAC name: 5-(1-methylpyrazol-4-yl)-1,2,3,6-tetrahydropyridine;dihydrochloride. InChIKey: YWTLPVKVZWKQCR-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 5-(1-methylpyrazol-4-yl)-1,2,3,6-tetrahydropyridine;dihydrochloride |
| InChIKey | YWTLPVKVZWKQCR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CCCNC2.Cl.Cl |
Computed by PubChem (NCBI)