CAS 52266-53-2 is the registry number for 1-(Pyridin-2-yl)piperazine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
1-pyridin-2-ylpiperazine;dihydrochloride (CAS 52266-53-2) is a chemical compound with the molecular formula C9H15Cl2N3 and a molecular weight of 236.14 g/mol. IUPAC name: 1-pyridin-2-ylpiperazine;dihydrochloride. InChIKey: SLVHMMBZOHKYBM-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 1-pyridin-2-ylpiperazine;dihydrochloride |
| InChIKey | SLVHMMBZOHKYBM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)