CAS 470441-67-9 appears in our catalog under these names: 1-Pyridin-3-yl-piperazine dihydrochloride, 96%, 1-(Pyridin-3-yl)piperazine dihydrochloride, 95%, 1–Pyridin–3–Yl–Piperazine Dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
1-pyridin-3-ylpiperazine;dihydrochloride (CAS 470441-67-9) is a chemical compound with the molecular formula C9H15Cl2N3 and a molecular weight of 236.14 g/mol. IUPAC name: 1-pyridin-3-ylpiperazine;dihydrochloride. InChIKey: RWTFYBJGFSEULO-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3 |
|---|---|
| Molecular weight | 236.14 g/mol |
| IUPAC name | 1-pyridin-3-ylpiperazine;dihydrochloride |
| InChIKey | RWTFYBJGFSEULO-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)