CAS 120314-14-9 is the registry number for N-Nitroso Tryptophol. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-nitrosoindol-3-yl)ethanol (CAS 120314-14-9) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-(1-nitrosoindol-3-yl)ethanol. InChIKey: LPKIJQXIHVWSIQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-(1-nitrosoindol-3-yl)ethanol |
| InChIKey | LPKIJQXIHVWSIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2N=O)CCO |
Computed by PubChem (NCBI)